About 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one
5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one (PubChem CID 2906737) has the molecular formula C23H20BrNO5
and a molecular weight of 470.32 g/mol. Its IUPAC name is 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one.
Molecular Properties
| Compound Name | 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one |
| PubChem CID | 2906737 |
| Molecular Formula | C23H20BrNO5 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one |
| SMILES | COc1cc(C2(c3ccc(O)c(OC)c3)C(=O)N(C)c3ccc(Br)cc32)ccc1O |
| InChI | InChI=1S/C23H20BrNO5/c1-25-17-7-6-15(24)12-16(17)23(22(25)28,13-4-8-18(26)20(10-13)29-2)14-5-9-19(27)21(11-14)30-3/h4-12,26-27H,1-3H3 |
| InChIKey | URMJMPRZBOCPDD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one?
The IUPAC name of 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one (CID 2906737) is 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one.
What is the SMILES notation for 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one?
The canonical SMILES for 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one is COc1cc(C2(c3ccc(O)c(OC)c3)C(=O)N(C)c3ccc(Br)cc32)ccc1O.
What is the InChIKey of 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one?
The InChIKey is URMJMPRZBOCPDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20BrNO5/c1-25-17-7-6-15(24)12-16(17)23(22(25)28,13-4-8-18(26)20(10-13)29-2)14-5-9-19(27)21(11-14)30-3/h4-12,26-27H,1-3H3.
What are the key properties of 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one?
5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one has a molecular weight of 470.32 g/mol, XLogP of 4.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,3-bis(4-hydroxy-3-methoxyphenyl)-1-methylindol-2-one is sourced from PubChem (CID 2906737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).