C13H9Cl2F3N2 — CID 29067483
1-N-(2,3-dichlorophenyl)-4-(trifluoromethyl)benzene-1,2-diamine (PubChem CID 29067483) has the molecular formula C13H9Cl2F3N2 and a molecular weight of 321.13 g/mol. Its IUPAC name is 1-N-(2,3-dichlorophenyl)-4-(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | 1-N-(2,3-dichlorophenyl)-4-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 29067483 |
| Molecular Formula | C13H9Cl2F3N2 |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 1-N-(2,3-dichlorophenyl)-4-(trifluoromethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(C(F)(F)F)ccc1Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl2F3N2/c14-8-2-1-3-11(12(8)15)20-10-5-4-7(6-9(10)19)13(16,17)18/h1-6,20H,19H2 |
| InChIKey | SQKUXOWWRPOZEY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|