C12H15BrClNO3 — CID 2906779
2-(4-bromo-2-chlorophenoxy)-N-(3-methoxypropyl)acetamide (PubChem CID 2906779) has the molecular formula C12H15BrClNO3 and a molecular weight of 336.61 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 2906779 |
| Molecular Formula | C12H15BrClNO3 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H15BrClNO3/c1-17-6-2-5-15-12(16)8-18-11-4-3-9(13)7-10(11)14/h3-4,7H,2,5-6,8H2,1H3,(H,15,16) |
| InChIKey | VRFAUEBVNGPASD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|