C15H23N3S — CID 29068172
N'-benzyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N'-methylpropane-1,3-diamine (PubChem CID 29068172) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is N'-benzyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N'-methylpropane-1,3-diamine.
| Compound Name | N'-benzyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 29068172 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N'-benzyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNC1=NCCCS1)Cc1ccccc1 |
| InChI | InChI=1S/C15H23N3S/c1-18(13-14-7-3-2-4-8-14)11-5-9-16-15-17-10-6-12-19-15/h2-4,7-8H,5-6,9-13H2,1H3,(H,16,17) |
| InChIKey | BBXOCEOZUZFJHE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|