C23H27N3OS — CID 29068330
1-[(3S)-3-[4-(2-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 29068330) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is 1-[(3S)-3-[4-(2-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[(3S)-3-[4-(2-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 29068330 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[(3S)-3-[4-(2-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | Cc1ccccc1-c1cn[nH]c1[C@H]1CCCN(C(=O)CCCc2cccs2)C1 |
| InChI | InChI=1S/C23H27N3OS/c1-17-7-2-3-11-20(17)21-15-24-25-23(21)18-8-5-13-26(16-18)22(27)12-4-9-19-10-6-14-28-19/h2-3,6-7,10-11,14-15,18H,4-5,8-9,12-13,16H2,1H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | FNCHZNJVNAKFAJ-SFHVURJKSA-N |
| XLogP | 5.18 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |