C26H24N4O4S — CID 2907286
2,6-dimethoxy-4-[3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol (PubChem CID 2907286) has the molecular formula C26H24N4O4S and a molecular weight of 488.57 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol.
| Compound Name | 2,6-dimethoxy-4-[3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol |
|---|---|
| PubChem CID | 2907286 |
| Molecular Formula | C26H24N4O4S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 2,6-dimethoxy-4-[3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol |
| SMILES | COc1cc(C2Nc3ccccc3-c3nnc(SCc4ccc(C)cc4)nc3O2)cc(OC)c1O |
| InChI | InChI=1S/C26H24N4O4S/c1-15-8-10-16(11-9-15)14-35-26-28-25-22(29-30-26)18-6-4-5-7-19(18)27-24(34-25)17-12-20(32-2)23(31)21(13-17)33-3/h4-13,24,27,31H,14H2,1-3H3 |
| InChIKey | HSYPDCIRBDSNBB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |