C10H17N3O2S — CID 29074632
2-[(5-methyl-4-pentyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (PubChem CID 29074632) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-[(5-methyl-4-pentyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(5-methyl-4-pentyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 29074632 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-[(5-methyl-4-pentyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| SMILES | CCCCCn1c(C)nnc1SCC(=O)O |
| InChI | InChI=1S/C10H17N3O2S/c1-3-4-5-6-13-8(2)11-12-10(13)16-7-9(14)15/h3-7H2,1-2H3,(H,14,15) |
| InChIKey | KNLBBUKZMSWQSV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|