C17H18N2O3S — CID 2907788
4-(1,3-benzodioxol-5-yl)-6-butylsulfanyl-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 2907788) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-6-butylsulfanyl-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-6-butylsulfanyl-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 2907788 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-6-butylsulfanyl-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | CCCCSC1=C(C#N)C(c2ccc3c(c2)OCO3)CC(=O)N1 |
| InChI | InChI=1S/C17H18N2O3S/c1-2-3-6-23-17-13(9-18)12(8-16(20)19-17)11-4-5-14-15(7-11)22-10-21-14/h4-5,7,12H,2-3,6,8,10H2,1H3,(H,19,20) |
| InChIKey | ZBRSFVFSHUOMSR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|