About 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid
2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid (PubChem CID 29078211) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid |
| PubChem CID | 29078211 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid |
| SMILES | CC(C)(C)c1noc(-c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C13H14N2O3/c1-13(2,3)12-14-10(18-15-12)8-6-4-5-7-9(8)11(16)17/h4-7H,1-3H3,(H,16,17) |
| InChIKey | PHDHRVFFYFFTIE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid?
The IUPAC name of 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid (CID 29078211) is 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid.
What is the SMILES notation for 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid?
The canonical SMILES for 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid is CC(C)(C)c1noc(-c2ccccc2C(=O)O)n1.
What is the InChIKey of 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid?
The InChIKey is PHDHRVFFYFFTIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c1-13(2,3)12-14-10(18-15-12)8-6-4-5-7-9(8)11(16)17/h4-7H,1-3H3,(H,16,17).
What are the key properties of 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid?
2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid has a molecular weight of 246.27 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid is sourced from PubChem (CID 29078211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).