About N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide
N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide (PubChem CID 2908235) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide.
Molecular Properties
| Compound Name | N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide |
| PubChem CID | 2908235 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC2OCCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-13-6-8-15(9-7-13)21-19(23)18(22)20-12-17-16-5-3-2-4-14(16)10-11-24-17/h2-9,17H,10-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | FMLAHQZKMCWVAU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide?
The IUPAC name of N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide (CID 2908235) is N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide.
What is the SMILES notation for N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide?
The canonical SMILES for N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide is Cc1ccc(NC(=O)C(=O)NCC2OCCc3ccccc32)cc1.
What is the InChIKey of N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide?
The InChIKey is FMLAHQZKMCWVAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-13-6-8-15(9-7-13)21-19(23)18(22)20-12-17-16-5-3-2-4-14(16)10-11-24-17/h2-9,17H,10-12H2,1H3,(H,20,22)(H,21,23).
What are the key properties of N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide?
N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide has a molecular weight of 324.38 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-N'-(4-methylphenyl)oxamide is sourced from PubChem (CID 2908235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).