C10H10N2O2S — CID 29085
2-(2-sulfanylidene-4H-1,3-benzoxazin-3-yl)acetamide (PubChem CID 29085) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-(2-sulfanylidene-4H-1,3-benzoxazin-3-yl)acetamide.
| Compound Name | 2-(2-sulfanylidene-4H-1,3-benzoxazin-3-yl)acetamide |
|---|---|
| PubChem CID | 29085 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-(2-sulfanylidene-4H-1,3-benzoxazin-3-yl)acetamide |
| SMILES | NC(=O)CN1Cc2ccccc2OC1=S |
| InChI | InChI=1S/C10H10N2O2S/c11-9(13)6-12-5-7-3-1-2-4-8(7)14-10(12)15/h1-4H,5-6H2,(H2,11,13) |
| InChIKey | PTEOKRZZXJSXLJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|