About 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol
2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol (PubChem CID 29085910) has the molecular formula C17H26N4OS
and a molecular weight of 334.49 g/mol. Its IUPAC name is 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol |
| PubChem CID | 29085910 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol |
| SMILES | Cc1cc(CN2CCC(n3cc(C(C)(C)O)nn3)CC2)c(C)s1 |
| InChI | InChI=1S/C17H26N4OS/c1-12-9-14(13(2)23-12)10-20-7-5-15(6-8-20)21-11-16(18-19-21)17(3,4)22/h9,11,15,22H,5-8,10H2,1-4H3 |
| InChIKey | YCBPSNDMDQHIFL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol?
The IUPAC name of 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol (CID 29085910) is 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol.
What is the SMILES notation for 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol?
The canonical SMILES for 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol is Cc1cc(CN2CCC(n3cc(C(C)(C)O)nn3)CC2)c(C)s1.
What is the InChIKey of 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol?
The InChIKey is YCBPSNDMDQHIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4OS/c1-12-9-14(13(2)23-12)10-20-7-5-15(6-8-20)21-11-16(18-19-21)17(3,4)22/h9,11,15,22H,5-8,10H2,1-4H3.
What are the key properties of 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol?
2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol has a molecular weight of 334.49 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[1-[(2,5-dimethylthiophen-3-yl)methyl]piperidin-4-yl]triazol-4-yl]propan-2-ol is sourced from PubChem (CID 29085910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).