About 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride
4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride (PubChem CID 2908640) has the molecular formula C20H19ClN4O
and a molecular weight of 366.85 g/mol. Its IUPAC name is 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride |
| PubChem CID | 2908640 |
| Molecular Formula | C20H19ClN4O |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride |
| SMILES | Cc1ccc(Nc2nc(NCc3ccco3)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C20H18N4O.ClH/c1-14-8-10-15(11-9-14)22-20-23-18-7-3-2-6-17(18)19(24-20)21-13-16-5-4-12-25-16;/h2-12H,13H2,1H3,(H2,21,22,23,24);1H |
| InChIKey | GCSDEOFLXWIZPE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'melamine_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride?
The IUPAC name of 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride (CID 2908640) is 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride.
What is the SMILES notation for 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride?
The canonical SMILES for 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride is Cc1ccc(Nc2nc(NCc3ccco3)c3ccccc3n2)cc1.Cl.
What is the InChIKey of 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride?
The InChIKey is GCSDEOFLXWIZPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O.ClH/c1-14-8-10-15(11-9-14)22-20-23-18-7-3-2-6-17(18)19(24-20)21-13-16-5-4-12-25-16;/h2-12H,13H2,1H3,(H2,21,22,23,24);1H.
What are the key properties of 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride?
4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride has a molecular weight of 366.85 g/mol, XLogP of 5.31, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(furan-2-ylmethyl)-2-N-(4-methylphenyl)quinazoline-2,4-diamine;hydrochloride is sourced from PubChem (CID 2908640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).