C18H17NO4 — CID 2908702
1-ethyl-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]indol-2-one (PubChem CID 2908702) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-ethyl-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]indol-2-one.
| Compound Name | 1-ethyl-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 2908702 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-ethyl-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]indol-2-one |
| SMILES | CCN1C(=O)C(O)(CC(=O)c2ccccc2O)c2ccccc21 |
| InChI | InChI=1S/C18H17NO4/c1-2-19-14-9-5-4-8-13(14)18(23,17(19)22)11-16(21)12-7-3-6-10-15(12)20/h3-10,20,23H,2,11H2,1H3 |
| InChIKey | BWEUFNXCVHGOEF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |