C25H32N4O2 — CID 29087201
azepan-1-yl-[3-[[2-(2-methoxyphenyl)ethylamino]methyl]-7-methylimidazo[1,2-a]pyridin-2-yl]methanone (PubChem CID 29087201) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is azepan-1-yl-[3-[[2-(2-methoxyphenyl)ethylamino]methyl]-7-methylimidazo[1,2-a]pyridin-2-yl]methanone.
| Compound Name | azepan-1-yl-[3-[[2-(2-methoxyphenyl)ethylamino]methyl]-7-methylimidazo[1,2-a]pyridin-2-yl]methanone |
|---|---|
| PubChem CID | 29087201 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | azepan-1-yl-[3-[[2-(2-methoxyphenyl)ethylamino]methyl]-7-methylimidazo[1,2-a]pyridin-2-yl]methanone |
| SMILES | COc1ccccc1CCNCc1c(C(=O)N2CCCCCC2)nc2cc(C)ccn12 |
| InChI | InChI=1S/C25H32N4O2/c1-19-12-16-29-21(18-26-13-11-20-9-5-6-10-22(20)31-2)24(27-23(29)17-19)25(30)28-14-7-3-4-8-15-28/h5-6,9-10,12,16-17,26H,3-4,7-8,11,13-15,18H2,1-2H3 |
| InChIKey | FCHZTFGFTWDEQC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|