C22H31N3O2 — CID 29088226
(4aR,8aS)-1-(3-ethoxypropyl)-6-(1H-indol-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 29088226) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (4aR,8aS)-1-(3-ethoxypropyl)-6-(1H-indol-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-(3-ethoxypropyl)-6-(1H-indol-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 29088226 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (4aR,8aS)-1-(3-ethoxypropyl)-6-(1H-indol-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCOCCCN1C(=O)CC[C@@H]2CN(Cc3cc4ccccc4[nH]3)CC[C@@H]21 |
| InChI | InChI=1S/C22H31N3O2/c1-2-27-13-5-11-25-21-10-12-24(15-18(21)8-9-22(25)26)16-19-14-17-6-3-4-7-20(17)23-19/h3-4,6-7,14,18,21,23H,2,5,8-13,15-16H2,1H3/t18-,21+/m1/s1 |
| InChIKey | SZDGOWZUKMBJQQ-NQIIRXRSSA-N |
| XLogP | 3.41 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|