C24H26N4O2 — CID 29088321
[(4aR,8aS)-1-(5-methyl-1H-indole-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-2-ylmethanone (PubChem CID 29088321) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is [(4aR,8aS)-1-(5-methyl-1H-indole-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-2-ylmethanone.
| Compound Name | [(4aR,8aS)-1-(5-methyl-1H-indole-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 29088321 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | [(4aR,8aS)-1-(5-methyl-1H-indole-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-2-ylmethanone |
| SMILES | Cc1ccc2[nH]c(C(=O)N3CCC[C@@H]4CN(C(=O)c5ccccn5)CC[C@@H]43)cc2c1 |
| InChI | InChI=1S/C24H26N4O2/c1-16-7-8-19-18(13-16)14-21(26-19)24(30)28-11-4-5-17-15-27(12-9-22(17)28)23(29)20-6-2-3-10-25-20/h2-3,6-8,10,13-14,17,22,26H,4-5,9,11-12,15H2,1H3/t17-,22+/m1/s1 |
| InChIKey | ODGNSBZTIXBPQV-VGSWGCGISA-N |
| XLogP | 3.64 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |