C14H18N2O2S — CID 2908925
4-methyl-N-(oxolan-2-ylmethylcarbamothioyl)benzamide (PubChem CID 2908925) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-methyl-N-(oxolan-2-ylmethylcarbamothioyl)benzamide.
| Compound Name | 4-methyl-N-(oxolan-2-ylmethylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 2908925 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-methyl-N-(oxolan-2-ylmethylcarbamothioyl)benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C14H18N2O2S/c1-10-4-6-11(7-5-10)13(17)16-14(19)15-9-12-3-2-8-18-12/h4-7,12H,2-3,8-9H2,1H3,(H2,15,16,17,19) |
| InChIKey | RPFREANMLWCYMJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|