About N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide
N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 29089522) has the molecular formula C14H23N5O2S
and a molecular weight of 325.44 g/mol. Its IUPAC name is N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide |
| PubChem CID | 29089522 |
| Molecular Formula | C14H23N5O2S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | CCN(Cc1c(C)nn(CC)c1C)S(=O)(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C14H23N5O2S/c1-6-18(22(20,21)13-8-15-17(5)9-13)10-14-11(3)16-19(7-2)12(14)4/h8-9H,6-7,10H2,1-5H3 |
| InChIKey | YEMYHGZJOMJPEQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide?
The IUPAC name of N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide (CID 29089522) is N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide.
What is the SMILES notation for N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide?
The canonical SMILES for N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide is CCN(Cc1c(C)nn(CC)c1C)S(=O)(=O)c1cnn(C)c1.
What is the InChIKey of N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide?
The InChIKey is YEMYHGZJOMJPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O2S/c1-6-18(22(20,21)13-8-15-17(5)9-13)10-14-11(3)16-19(7-2)12(14)4/h8-9H,6-7,10H2,1-5H3.
What are the key properties of N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide?
N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide has a molecular weight of 325.44 g/mol, XLogP of 1.46, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide is sourced from PubChem (CID 29089522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).