About 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine
4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine (PubChem CID 29090055) has the molecular formula C22H19F2N3O2
and a molecular weight of 395.41 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine |
| PubChem CID | 29090055 |
| Molecular Formula | C22H19F2N3O2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine |
| SMILES | COc1ccc(-c2cc(C(F)F)c3c(C)nn(-c4ccc(OC)cc4)c3n2)cc1 |
| InChI | InChI=1S/C22H19F2N3O2/c1-13-20-18(21(23)24)12-19(14-4-8-16(28-2)9-5-14)25-22(20)27(26-13)15-6-10-17(29-3)11-7-15/h4-12,21H,1-3H3 |
| InChIKey | IEBLTJYHEXYTSL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine?
The IUPAC name of 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine (CID 29090055) is 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine.
What is the SMILES notation for 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine?
The canonical SMILES for 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine is COc1ccc(-c2cc(C(F)F)c3c(C)nn(-c4ccc(OC)cc4)c3n2)cc1.
What is the InChIKey of 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine?
The InChIKey is IEBLTJYHEXYTSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2N3O2/c1-13-20-18(21(23)24)12-19(14-4-8-16(28-2)9-5-14)25-22(20)27(26-13)15-6-10-17(29-3)11-7-15/h4-12,21H,1-3H3.
What are the key properties of 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine?
4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine has a molecular weight of 395.41 g/mol, XLogP of 5.35, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-1,6-bis(4-methoxyphenyl)-3-methylpyrazolo[5,4-b]pyridine is sourced from PubChem (CID 29090055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).