C24H21F2N3O4S — CID 29090084
5-(difluoromethyl)-7-(3,4-dimethoxyphenyl)-1-(2-ethoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one (PubChem CID 29090084) has the molecular formula C24H21F2N3O4S and a molecular weight of 485.51 g/mol. Its IUPAC name is 5-(difluoromethyl)-7-(3,4-dimethoxyphenyl)-1-(2-ethoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(difluoromethyl)-7-(3,4-dimethoxyphenyl)-1-(2-ethoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29090084 |
| Molecular Formula | C24H21F2N3O4S |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 5-(difluoromethyl)-7-(3,4-dimethoxyphenyl)-1-(2-ethoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1ccccc1-n1c(=S)[nH]c(=O)c2c(C(F)F)cc(-c3ccc(OC)c(OC)c3)nc21 |
| InChI | InChI=1S/C24H21F2N3O4S/c1-4-33-17-8-6-5-7-16(17)29-22-20(23(30)28-24(29)34)14(21(25)26)12-15(27-22)13-9-10-18(31-2)19(11-13)32-3/h5-12,21H,4H2,1-3H3,(H,28,30,34) |
| InChIKey | MADJYHIDPDXJDK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|