C19H25F3N6O2 — CID 29091707
5-[(5R,7S)-2,5-dimethyl-7-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidine-4-carbonyl]-N,N-diethyl-1-methylpyrazole-3-carboxamide (PubChem CID 29091707) has the molecular formula C19H25F3N6O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is 5-[(5R,7S)-2,5-dimethyl-7-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidine-4-carbonyl]-N,N-diethyl-1-methylpyrazole-3-carboxamide.
| Compound Name | 5-[(5R,7S)-2,5-dimethyl-7-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidine-4-carbonyl]-N,N-diethyl-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 29091707 |
| Molecular Formula | C19H25F3N6O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 5-[(5R,7S)-2,5-dimethyl-7-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidine-4-carbonyl]-N,N-diethyl-1-methylpyrazole-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(C(=O)N2c3cc(C)nn3[C@H](C(F)(F)F)C[C@H]2C)n(C)n1 |
| InChI | InChI=1S/C19H25F3N6O2/c1-6-26(7-2)17(29)13-10-14(25(5)24-13)18(30)27-12(4)9-15(19(20,21)22)28-16(27)8-11(3)23-28/h8,10,12,15H,6-7,9H2,1-5H3/t12-,15+/m1/s1 |
| InChIKey | ZLAIFHKHIZJRST-DOMZBBRYSA-N |
| XLogP | 2.95 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |