C18H23N3O6 — CID 29092174
(2S)-2-(4-nitrophenoxy)-1-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]propan-1-one (PubChem CID 29092174) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is (2S)-2-(4-nitrophenoxy)-1-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]propan-1-one.
| Compound Name | (2S)-2-(4-nitrophenoxy)-1-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 29092174 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2S)-2-(4-nitrophenoxy)-1-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]propan-1-one |
| SMILES | C[C@H](Oc1ccc([N+](=O)[O-])cc1)C(=O)N1CCN(C(=O)[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C18H23N3O6/c1-13(27-15-6-4-14(5-7-15)21(24)25)17(22)19-8-10-20(11-9-19)18(23)16-3-2-12-26-16/h4-7,13,16H,2-3,8-12H2,1H3/t13-,16-/m0/s1 |
| InChIKey | OSTPBUZBUGIJKP-BBRMVZONSA-N |
| XLogP | 1.21 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|