About 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide
5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide (PubChem CID 29092185) has the molecular formula C16H18BrN5O2
and a molecular weight of 392.26 g/mol. Its IUPAC name is 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide |
| PubChem CID | 29092185 |
| Molecular Formula | C16H18BrN5O2 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide |
| SMILES | CCn1ccc(NC(=O)c2ccc(Cn3nc(C)c(Br)c3C)o2)n1 |
| InChI | InChI=1S/C16H18BrN5O2/c1-4-21-8-7-14(20-21)18-16(23)13-6-5-12(24-13)9-22-11(3)15(17)10(2)19-22/h5-8H,4,9H2,1-3H3,(H,18,20,23) |
| InChIKey | ZKGGUFYCNBDPHQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide?
The IUPAC name of 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide (CID 29092185) is 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide.
What is the SMILES notation for 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide?
The canonical SMILES for 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide is CCn1ccc(NC(=O)c2ccc(Cn3nc(C)c(Br)c3C)o2)n1.
What is the InChIKey of 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide?
The InChIKey is ZKGGUFYCNBDPHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrN5O2/c1-4-21-8-7-14(20-21)18-16(23)13-6-5-12(24-13)9-22-11(3)15(17)10(2)19-22/h5-8H,4,9H2,1-3H3,(H,18,20,23).
What are the key properties of 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide?
5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide has a molecular weight of 392.26 g/mol, XLogP of 3.37, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(1-ethylpyrazol-3-yl)furan-2-carboxamide is sourced from PubChem (CID 29092185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).