C17H24BrN3O2S — CID 29092810
N-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-4-[(2S)-butan-2-yl]-N-methylbenzenesulfonamide (PubChem CID 29092810) has the molecular formula C17H24BrN3O2S and a molecular weight of 414.37 g/mol. Its IUPAC name is N-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-4-[(2S)-butan-2-yl]-N-methylbenzenesulfonamide.
| Compound Name | N-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-4-[(2S)-butan-2-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 29092810 |
| Molecular Formula | C17H24BrN3O2S |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-4-[(2S)-butan-2-yl]-N-methylbenzenesulfonamide |
| SMILES | CC[C@H](C)c1ccc(S(=O)(=O)N(C)Cc2c(Br)cnn2CC)cc1 |
| InChI | InChI=1S/C17H24BrN3O2S/c1-5-13(3)14-7-9-15(10-8-14)24(22,23)20(4)12-17-16(18)11-19-21(17)6-2/h7-11,13H,5-6,12H2,1-4H3/t13-/m0/s1 |
| InChIKey | IEONWTLFVJYWFW-ZDUSSCGKSA-N |
| XLogP | 4.00 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |