C25H20N2O6 — CID 29093546
ethyl (3S)-2'-amino-2,4-dioxo-1'-prop-2-enylspiro[furo[3,2-c]chromene-3,4'-quinoline]-3'-carboxylate (PubChem CID 29093546) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is ethyl (3S)-2'-amino-2,4-dioxo-1'-prop-2-enylspiro[furo[3,2-c]chromene-3,4'-quinoline]-3'-carboxylate.
| Compound Name | ethyl (3S)-2'-amino-2,4-dioxo-1'-prop-2-enylspiro[furo[3,2-c]chromene-3,4'-quinoline]-3'-carboxylate |
|---|---|
| PubChem CID | 29093546 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | ethyl (3S)-2'-amino-2,4-dioxo-1'-prop-2-enylspiro[furo[3,2-c]chromene-3,4'-quinoline]-3'-carboxylate |
| SMILES | C=CCN1C(N)=C(C(=O)OCC)[C@@]2(C(=O)Oc3c2c(=O)oc2ccccc32)c2ccccc21 |
| InChI | InChI=1S/C25H20N2O6/c1-3-13-27-16-11-7-6-10-15(16)25(19(21(27)26)22(28)31-4-2)18-20(33-24(25)30)14-9-5-8-12-17(14)32-23(18)29/h3,5-12H,1,4,13,26H2,2H3/t25-/m1/s1 |
| InChIKey | LETZKZQEKXIVLD-RUZDIDTESA-N |
| XLogP | 2.74 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|