C24H19N3O5 — CID 29093757
ethyl (7R,12E)-4-amino-12-benzylidene-11-oxo-7-phenyl-3,10-dioxa-1,5-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-triene-8-carboxylate (PubChem CID 29093757) has the molecular formula C24H19N3O5 and a molecular weight of 429.43 g/mol. Its IUPAC name is ethyl (7R,12E)-4-amino-12-benzylidene-11-oxo-7-phenyl-3,10-dioxa-1,5-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-triene-8-carboxylate.
| Compound Name | ethyl (7R,12E)-4-amino-12-benzylidene-11-oxo-7-phenyl-3,10-dioxa-1,5-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-triene-8-carboxylate |
|---|---|
| PubChem CID | 29093757 |
| Molecular Formula | C24H19N3O5 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | ethyl (7R,12E)-4-amino-12-benzylidene-11-oxo-7-phenyl-3,10-dioxa-1,5-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-triene-8-carboxylate |
| SMILES | CCOC(=O)C1=c2oc(=O)/c(=C\c3ccccc3)n2-c2oc(N)nc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H19N3O5/c1-2-30-23(29)18-17(15-11-7-4-8-12-15)19-21(32-24(25)26-19)27-16(22(28)31-20(18)27)13-14-9-5-3-6-10-14/h3-13,17H,2H2,1H3,(H2,25,26)/b16-13+/t17-/m1/s1 |
| InChIKey | VLAHQJAUMCMHFF-HJUDDPQBSA-N |
| XLogP | 1.69 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |