C20H15N3O4 — CID 29095894
1-methyl-3-[(2-phenyl-1-benzofuran-7-yl)carbamoyl]pyrazole-4-carboxylic acid (PubChem CID 29095894) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 1-methyl-3-[(2-phenyl-1-benzofuran-7-yl)carbamoyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-3-[(2-phenyl-1-benzofuran-7-yl)carbamoyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 29095894 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-methyl-3-[(2-phenyl-1-benzofuran-7-yl)carbamoyl]pyrazole-4-carboxylic acid |
| SMILES | Cn1cc(C(=O)O)c(C(=O)Nc2cccc3cc(-c4ccccc4)oc23)n1 |
| InChI | InChI=1S/C20H15N3O4/c1-23-11-14(20(25)26)17(22-23)19(24)21-15-9-5-8-13-10-16(27-18(13)15)12-6-3-2-4-7-12/h2-11H,1H3,(H,21,24)(H,25,26) |
| InChIKey | PFLGNTPSNZTMHR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |