C17H13Cl2F2N3O2S — CID 29096338
7-(3,4-dichlorophenyl)-5-(difluoromethyl)-1-(2-methoxyethyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one (PubChem CID 29096338) has the molecular formula C17H13Cl2F2N3O2S and a molecular weight of 432.28 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-5-(difluoromethyl)-1-(2-methoxyethyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 7-(3,4-dichlorophenyl)-5-(difluoromethyl)-1-(2-methoxyethyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29096338 |
| Molecular Formula | C17H13Cl2F2N3O2S |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-5-(difluoromethyl)-1-(2-methoxyethyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
| SMILES | COCCn1c(=S)[nH]c(=O)c2c(C(F)F)cc(-c3ccc(Cl)c(Cl)c3)nc21 |
| InChI | InChI=1S/C17H13Cl2F2N3O2S/c1-26-5-4-24-15-13(16(25)23-17(24)27)9(14(20)21)7-12(22-15)8-2-3-10(18)11(19)6-8/h2-3,6-7,14H,4-5H2,1H3,(H,23,25,27) |
| InChIKey | FIDHAONSNRLOJT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|