C14H11F3N4O2 — CID 29096465
methyl 4,13-dimethyl-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate (PubChem CID 29096465) has the molecular formula C14H11F3N4O2 and a molecular weight of 324.26 g/mol. Its IUPAC name is methyl 4,13-dimethyl-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate.
| Compound Name | methyl 4,13-dimethyl-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate |
|---|---|
| PubChem CID | 29096465 |
| Molecular Formula | C14H11F3N4O2 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | methyl 4,13-dimethyl-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate |
| SMILES | COC(=O)c1cc(C)nc2c3c(C)cc(C(F)(F)F)nc3nn12 |
| InChI | InChI=1S/C14H11F3N4O2/c1-6-4-9(14(15,16)17)19-11-10(6)12-18-7(2)5-8(13(22)23-3)21(12)20-11/h4-5H,1-3H3 |
| InChIKey | IWBGHBMDDTZDSJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |