About 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide
2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide (PubChem CID 2909654) has the molecular formula C12H17N5O
and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide |
| PubChem CID | 2909654 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide |
| SMILES | Cc1cc(C)nc(N(C#N)C(C)C(=O)N(C)C)n1 |
| InChI | InChI=1S/C12H17N5O/c1-8-6-9(2)15-12(14-8)17(7-13)10(3)11(18)16(4)5/h6,10H,1-5H3 |
| InChIKey | ZULIUEWWTHYCNQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide?
The IUPAC name of 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide (CID 2909654) is 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide.
What is the SMILES notation for 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide?
The canonical SMILES for 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide is Cc1cc(C)nc(N(C#N)C(C)C(=O)N(C)C)n1.
What is the InChIKey of 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide?
The InChIKey is ZULIUEWWTHYCNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O/c1-8-6-9(2)15-12(14-8)17(7-13)10(3)11(18)16(4)5/h6,10H,1-5H3.
What are the key properties of 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide?
2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide has a molecular weight of 247.30 g/mol, XLogP of 0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-dimethylpropanamide is sourced from PubChem (CID 2909654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).