About 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide
4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide (PubChem CID 29096933) has the molecular formula C20H18F2N4O2
and a molecular weight of 384.39 g/mol. Its IUPAC name is 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide.
Molecular Properties
| Compound Name | 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide |
| PubChem CID | 29096933 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2cnn(C)c2C(=O)Nc2cc(C)ccc2F)c1 |
| InChI | InChI=1S/C20H18F2N4O2/c1-11-4-6-14(21)16(8-11)24-19(27)13-10-23-26(3)18(13)20(28)25-17-9-12(2)5-7-15(17)22/h4-10H,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | ZESZOBAAMIOELA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide?
The IUPAC name of 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide (CID 29096933) is 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide.
What is the SMILES notation for 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide?
The canonical SMILES for 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide is Cc1ccc(F)c(NC(=O)c2cnn(C)c2C(=O)Nc2cc(C)ccc2F)c1.
What is the InChIKey of 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide?
The InChIKey is ZESZOBAAMIOELA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2N4O2/c1-11-4-6-14(21)16(8-11)24-19(27)13-10-23-26(3)18(13)20(28)25-17-9-12(2)5-7-15(17)22/h4-10H,1-3H3,(H,24,27)(H,25,28).
What are the key properties of 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide?
4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide has a molecular weight of 384.39 g/mol, XLogP of 3.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,5-N-bis(2-fluoro-5-methylphenyl)-1-methylpyrazole-4,5-dicarboxamide is sourced from PubChem (CID 29096933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).