C20H18Cl2N4O4 — CID 29097288
3-N,5-N-bis(5-chloro-2-methoxyphenyl)-1-methylpyrazole-3,5-dicarboxamide (PubChem CID 29097288) has the molecular formula C20H18Cl2N4O4 and a molecular weight of 449.29 g/mol. Its IUPAC name is 3-N,5-N-bis(5-chloro-2-methoxyphenyl)-1-methylpyrazole-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis(5-chloro-2-methoxyphenyl)-1-methylpyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 29097288 |
| Molecular Formula | C20H18Cl2N4O4 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 3-N,5-N-bis(5-chloro-2-methoxyphenyl)-1-methylpyrazole-3,5-dicarboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1cc(C(=O)Nc2cc(Cl)ccc2OC)n(C)n1 |
| InChI | InChI=1S/C20H18Cl2N4O4/c1-26-16(20(28)24-14-9-12(22)5-7-18(14)30-3)10-15(25-26)19(27)23-13-8-11(21)4-6-17(13)29-2/h4-10H,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | FOZUGLIMVXUBHV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |