C22H24N4O2 — CID 29097744
3-N,4-N-diethyl-1-methyl-3-N,4-N-diphenylpyrazole-3,4-dicarboxamide (PubChem CID 29097744) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-N,4-N-diethyl-1-methyl-3-N,4-N-diphenylpyrazole-3,4-dicarboxamide.
| Compound Name | 3-N,4-N-diethyl-1-methyl-3-N,4-N-diphenylpyrazole-3,4-dicarboxamide |
|---|---|
| PubChem CID | 29097744 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-N,4-N-diethyl-1-methyl-3-N,4-N-diphenylpyrazole-3,4-dicarboxamide |
| SMILES | CCN(C(=O)c1cn(C)nc1C(=O)N(CC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N4O2/c1-4-25(17-12-8-6-9-13-17)21(27)19-16-24(3)23-20(19)22(28)26(5-2)18-14-10-7-11-15-18/h6-16H,4-5H2,1-3H3 |
| InChIKey | PBAIMAKPVRLDCR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |