C25H24BrNO4 — CID 29098779
(2Z)-2-[(5-bromo-1-benzofuran-2-yl)methylidene]-7-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-1-benzofuran-3-one (PubChem CID 29098779) has the molecular formula C25H24BrNO4 and a molecular weight of 482.37 g/mol. Its IUPAC name is (2Z)-2-[(5-bromo-1-benzofuran-2-yl)methylidene]-7-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(5-bromo-1-benzofuran-2-yl)methylidene]-7-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 29098779 |
| Molecular Formula | C25H24BrNO4 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | (2Z)-2-[(5-bromo-1-benzofuran-2-yl)methylidene]-7-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-1-benzofuran-3-one |
| SMILES | C[C@H]1C[C@H](C)CN(Cc2c(O)ccc3c2O/C(=C\c2cc4cc(Br)ccc4o2)C3=O)C1 |
| InChI | InChI=1S/C25H24BrNO4/c1-14-7-15(2)12-27(11-14)13-20-21(28)5-4-19-24(29)23(31-25(19)20)10-18-9-16-8-17(26)3-6-22(16)30-18/h3-6,8-10,14-15,28H,7,11-13H2,1-2H3/b23-10-/t14-,15-/m0/s1 |
| InChIKey | WXVVYZNDIKTCAH-KPNMMZSSSA-N |
| XLogP | 5.99 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|