C15H12O5 — CID 2909986
(10Z)-10-(hydroxymethylidene)-8,8-dimethylpyrano[2,3-f]chromene-2,9-dione (PubChem CID 2909986) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is (10Z)-10-(hydroxymethylidene)-8,8-dimethylpyrano[2,3-f]chromene-2,9-dione.
| Compound Name | (10Z)-10-(hydroxymethylidene)-8,8-dimethylpyrano[2,3-f]chromene-2,9-dione |
|---|---|
| PubChem CID | 2909986 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (10Z)-10-(hydroxymethylidene)-8,8-dimethylpyrano[2,3-f]chromene-2,9-dione |
| SMILES | CC1(C)Oc2ccc3ccc(=O)oc3c2/C(=C/O)C1=O |
| InChI | InChI=1S/C15H12O5/c1-15(2)14(18)9(7-16)12-10(20-15)5-3-8-4-6-11(17)19-13(8)12/h3-7,16H,1-2H3/b9-7- |
| InChIKey | PKZPZORLDZRVPS-CLFYSBASSA-N |
| XLogP | 2.43 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|