C14H18N4OS — CID 29100584
(6R)-2-butylsulfanyl-6-methyl-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 29100584) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is (6R)-2-butylsulfanyl-6-methyl-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R)-2-butylsulfanyl-6-methyl-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 29100584 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (6R)-2-butylsulfanyl-6-methyl-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCSc1nc2nc3c(cn2n1)C(=O)C[C@H](C)C3 |
| InChI | InChI=1S/C14H18N4OS/c1-3-4-5-20-14-16-13-15-11-6-9(2)7-12(19)10(11)8-18(13)17-14/h8-9H,3-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | QSMGFKNTOBLMMZ-SECBINFHSA-N |
| XLogP | 2.78 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|