C19H24O5 — CID 2910254
ethyl 3-benzyl-5,5,6,6-tetramethyl-2,4-dioxooxane-3-carboxylate (PubChem CID 2910254) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl 3-benzyl-5,5,6,6-tetramethyl-2,4-dioxooxane-3-carboxylate.
| Compound Name | ethyl 3-benzyl-5,5,6,6-tetramethyl-2,4-dioxooxane-3-carboxylate |
|---|---|
| PubChem CID | 2910254 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | ethyl 3-benzyl-5,5,6,6-tetramethyl-2,4-dioxooxane-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)C(=O)OC(C)(C)C(C)(C)C1=O |
| InChI | InChI=1S/C19H24O5/c1-6-23-15(21)19(12-13-10-8-7-9-11-13)14(20)17(2,3)18(4,5)24-16(19)22/h7-11H,6,12H2,1-5H3 |
| InChIKey | PLCXHBPPQGVIKL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|