C16H19N7O — CID 29103270
3-[[(2R)-oxolan-2-yl]methyl]-1-(1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole (PubChem CID 29103270) has the molecular formula C16H19N7O and a molecular weight of 325.38 g/mol. Its IUPAC name is 3-[[(2R)-oxolan-2-yl]methyl]-1-(1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole.
| Compound Name | 3-[[(2R)-oxolan-2-yl]methyl]-1-(1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 29103270 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-[[(2R)-oxolan-2-yl]methyl]-1-(1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole |
| SMILES | c1ccc2c(c1)nc1n2CN(C[C@H]2CCCO2)CN1n1cnnc1 |
| InChI | InChI=1S/C16H19N7O/c1-2-6-15-14(5-1)19-16-22(15)11-20(8-13-4-3-7-24-13)12-23(16)21-9-17-18-10-21/h1-2,5-6,9-10,13H,3-4,7-8,11-12H2/t13-/m1/s1 |
| InChIKey | FZYPIXAMMNHMHN-CYBMUJFWSA-N |
| XLogP | 1.31 |
| TPSA | 64.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |