About N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide
N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide (PubChem CID 29105716) has the molecular formula C14H21N3O3
and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide |
| PubChem CID | 29105716 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide |
| SMILES | CC(C)C(=O)N1CCC(CNC(=O)c2ccno2)CC1 |
| InChI | InChI=1S/C14H21N3O3/c1-10(2)14(19)17-7-4-11(5-8-17)9-15-13(18)12-3-6-16-20-12/h3,6,10-11H,4-5,7-9H2,1-2H3,(H,15,18) |
| InChIKey | WFXFBZWDNWNPAU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide?
The IUPAC name of N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide (CID 29105716) is N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide is CC(C)C(=O)N1CCC(CNC(=O)c2ccno2)CC1.
What is the InChIKey of N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide?
The InChIKey is WFXFBZWDNWNPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3/c1-10(2)14(19)17-7-4-11(5-8-17)9-15-13(18)12-3-6-16-20-12/h3,6,10-11H,4-5,7-9H2,1-2H3,(H,15,18).
What are the key properties of N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide?
N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide has a molecular weight of 279.34 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2-methylpropanoyl)piperidin-4-yl]methyl]-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 29105716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).