C20H19ClN4O — CID 2910633
4-N-(furan-2-ylmethyl)-2-N-(3-methylphenyl)quinazoline-2,4-diamine;hydrochloride (PubChem CID 2910633) has the molecular formula C20H19ClN4O and a molecular weight of 366.85 g/mol. Its IUPAC name is 4-N-(furan-2-ylmethyl)-2-N-(3-methylphenyl)quinazoline-2,4-diamine;hydrochloride.
| Compound Name | 4-N-(furan-2-ylmethyl)-2-N-(3-methylphenyl)quinazoline-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 2910633 |
| Molecular Formula | C20H19ClN4O |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-N-(furan-2-ylmethyl)-2-N-(3-methylphenyl)quinazoline-2,4-diamine;hydrochloride |
| SMILES | Cc1cccc(Nc2nc(NCc3ccco3)c3ccccc3n2)c1.Cl |
| InChI | InChI=1S/C20H18N4O.ClH/c1-14-6-4-7-15(12-14)22-20-23-18-10-3-2-9-17(18)19(24-20)21-13-16-8-5-11-25-16;/h2-12H,13H2,1H3,(H2,21,22,23,24);1H |
| InChIKey | NRPLBPOGGORNDR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'melamine_A(3)', 'substructure': 'N/A'} |
|---|