C21H21N3O — CID 29109043
(6R)-6-methyl-3-(4-methylanilino)-1-phenyl-6,7-dihydro-5H-indazol-4-one (PubChem CID 29109043) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (6R)-6-methyl-3-(4-methylanilino)-1-phenyl-6,7-dihydro-5H-indazol-4-one.
| Compound Name | (6R)-6-methyl-3-(4-methylanilino)-1-phenyl-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 29109043 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (6R)-6-methyl-3-(4-methylanilino)-1-phenyl-6,7-dihydro-5H-indazol-4-one |
| SMILES | Cc1ccc(Nc2nn(-c3ccccc3)c3c2C(=O)C[C@H](C)C3)cc1 |
| InChI | InChI=1S/C21H21N3O/c1-14-8-10-16(11-9-14)22-21-20-18(12-15(2)13-19(20)25)24(23-21)17-6-4-3-5-7-17/h3-11,15H,12-13H2,1-2H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | PXQPITMCLYNEEE-OAHLLOKOSA-N |
| XLogP | 4.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |