C25H29N3O4 — CID 29110900
ethyl (3S,4S)-4-(4-methoxyphenyl)-2-oxo-1-pentyl-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 29110900) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is ethyl (3S,4S)-4-(4-methoxyphenyl)-2-oxo-1-pentyl-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl (3S,4S)-4-(4-methoxyphenyl)-2-oxo-1-pentyl-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 29110900 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | ethyl (3S,4S)-4-(4-methoxyphenyl)-2-oxo-1-pentyl-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCCCCN1C(=O)[C@@H](C(=O)OCC)[C@@H](c2ccc(OC)cc2)n2c1nc1ccccc12 |
| InChI | InChI=1S/C25H29N3O4/c1-4-6-9-16-27-23(29)21(24(30)32-5-2)22(17-12-14-18(31-3)15-13-17)28-20-11-8-7-10-19(20)26-25(27)28/h7-8,10-15,21-22H,4-6,9,16H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | FIADPNGBWJGJPO-FCHUYYIVSA-N |
| XLogP | 4.35 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|