C21H22FN3O2 — CID 29112289
(2R)-2-(4-benzylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid (PubChem CID 29112289) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is (2R)-2-(4-benzylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid.
| Compound Name | (2R)-2-(4-benzylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 29112289 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (2R)-2-(4-benzylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid |
| SMILES | O=C(O)[C@@H](c1c[nH]c2cc(F)ccc12)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22FN3O2/c22-16-6-7-17-18(13-23-19(17)12-16)20(21(26)27)25-10-8-24(9-11-25)14-15-4-2-1-3-5-15/h1-7,12-13,20,23H,8-11,14H2,(H,26,27)/t20-/m1/s1 |
| InChIKey | PUKGAETURTZSPL-HXUWFJFHSA-N |
| XLogP | 3.25 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |