About N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid
N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid (PubChem CID 2911518) has the molecular formula C31H38N2O6
and a molecular weight of 534.65 g/mol. Its IUPAC name is N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid.
Molecular Properties
| Compound Name | N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid |
| PubChem CID | 2911518 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid |
| SMILES | COc1ccc(CN2CCC(N(CCc3ccccc3)Cc3ccccc3)CC2)c(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H36N2O2.C2H2O4/c1-32-28-14-13-26(29(21-28)33-2)23-30-18-16-27(17-19-30)31(22-25-11-7-4-8-12-25)20-15-24-9-5-3-6-10-24;3-1(4)2(5)6/h3-14,21,27H,15-20,22-23H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | NWYIXAKRNPCAMG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid?
The IUPAC name of N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid (CID 2911518) is N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid.
What is the SMILES notation for N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid?
The canonical SMILES for N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid is COc1ccc(CN2CCC(N(CCc3ccccc3)Cc3ccccc3)CC2)c(OC)c1.O=C(O)C(=O)O.
What is the InChIKey of N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid?
The InChIKey is NWYIXAKRNPCAMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H36N2O2.C2H2O4/c1-32-28-14-13-26(29(21-28)33-2)23-30-18-16-27(17-19-30)31(22-25-11-7-4-8-12-25)20-15-24-9-5-3-6-10-24;3-1(4)2(5)6/h3-14,21,27H,15-20,22-23H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid?
N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid has a molecular weight of 534.65 g/mol, XLogP of 4.57, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-N-(2-phenylethyl)piperidin-4-amine;oxalic acid is sourced from PubChem (CID 2911518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).