C10H14F3N3O3 — CID 2911644
2-oxo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]piperidine-3-carboxamide (PubChem CID 2911644) has the molecular formula C10H14F3N3O3 and a molecular weight of 281.23 g/mol. Its IUPAC name is 2-oxo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]piperidine-3-carboxamide.
| Compound Name | 2-oxo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 2911644 |
| Molecular Formula | C10H14F3N3O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-oxo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]piperidine-3-carboxamide |
| SMILES | O=C1NCCCC1C(=O)NCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O3/c11-10(12,13)9(19)16-5-4-15-8(18)6-2-1-3-14-7(6)17/h6H,1-5H2,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | CURPPONJLUUDJK-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|