C18H14O4S — CID 2911790
(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) thiophene-2-carboxylate (PubChem CID 2911790) has the molecular formula C18H14O4S and a molecular weight of 326.37 g/mol. Its IUPAC name is (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) thiophene-2-carboxylate.
| Compound Name | (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2911790 |
| Molecular Formula | C18H14O4S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) thiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc2c3c(c(=O)oc2c1)CCCC3)c1cccs1 |
| InChI | InChI=1S/C18H14O4S/c19-17-14-5-2-1-4-12(14)13-8-7-11(10-15(13)22-17)21-18(20)16-6-3-9-23-16/h3,6-10H,1-2,4-5H2 |
| InChIKey | FHXWTXWRUARUAH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|