About (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride
(1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride (PubChem CID 2911831) has the molecular formula C15H22ClNO3
and a molecular weight of 299.80 g/mol. Its IUPAC name is (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride |
| PubChem CID | 2911831 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride |
| SMILES | CCOc1ccc(C(=O)OC2CCCN(C)C2)cc1.Cl |
| InChI | InChI=1S/C15H21NO3.ClH/c1-3-18-13-8-6-12(7-9-13)15(17)19-14-5-4-10-16(2)11-14;/h6-9,14H,3-5,10-11H2,1-2H3;1H |
| InChIKey | HVMMCWNUHICWHV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride?
The IUPAC name of (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride (CID 2911831) is (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride.
What is the SMILES notation for (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride?
The canonical SMILES for (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride is CCOc1ccc(C(=O)OC2CCCN(C)C2)cc1.Cl.
What is the InChIKey of (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride?
The InChIKey is HVMMCWNUHICWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3.ClH/c1-3-18-13-8-6-12(7-9-13)15(17)19-14-5-4-10-16(2)11-14;/h6-9,14H,3-5,10-11H2,1-2H3;1H.
What are the key properties of (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride?
(1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride has a molecular weight of 299.80 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-3-yl) 4-ethoxybenzoate;hydrochloride is sourced from PubChem (CID 2911831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).