About 2-(benzotriazol-1-yl)-1,2-diphenylethanone
2-(benzotriazol-1-yl)-1,2-diphenylethanone (PubChem CID 2912246) has the molecular formula C20H15N3O
and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-1,2-diphenylethanone.
Molecular Properties
| Compound Name | 2-(benzotriazol-1-yl)-1,2-diphenylethanone |
| PubChem CID | 2912246 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(benzotriazol-1-yl)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(c1ccccc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C20H15N3O/c24-20(16-11-5-2-6-12-16)19(15-9-3-1-4-10-15)23-18-14-8-7-13-17(18)21-22-23/h1-14,19H |
| InChIKey | DVVYSUCBMDZKKF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzotriazol-1-yl)-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-1-yl)-1,2-diphenylethanone?
The IUPAC name of 2-(benzotriazol-1-yl)-1,2-diphenylethanone (CID 2912246) is 2-(benzotriazol-1-yl)-1,2-diphenylethanone.
What is the SMILES notation for 2-(benzotriazol-1-yl)-1,2-diphenylethanone?
The canonical SMILES for 2-(benzotriazol-1-yl)-1,2-diphenylethanone is O=C(c1ccccc1)C(c1ccccc1)n1nnc2ccccc21.
What is the InChIKey of 2-(benzotriazol-1-yl)-1,2-diphenylethanone?
The InChIKey is DVVYSUCBMDZKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O/c24-20(16-11-5-2-6-12-16)19(15-9-3-1-4-10-15)23-18-14-8-7-13-17(18)21-22-23/h1-14,19H.
What are the key properties of 2-(benzotriazol-1-yl)-1,2-diphenylethanone?
2-(benzotriazol-1-yl)-1,2-diphenylethanone has a molecular weight of 313.36 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-1-yl)-1,2-diphenylethanone is sourced from PubChem (CID 2912246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).