C17H18N2O6S — CID 2912315
5-[(3-hydroxy-4-methoxyphenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 2912315) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is 5-[(3-hydroxy-4-methoxyphenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(3-hydroxy-4-methoxyphenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2912315 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 5-[(3-hydroxy-4-methoxyphenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C=C2SC(=O)N(CC(=O)N3CCOCC3)C2=O)cc1O |
| InChI | InChI=1S/C17H18N2O6S/c1-24-13-3-2-11(8-12(13)20)9-14-16(22)19(17(23)26-14)10-15(21)18-4-6-25-7-5-18/h2-3,8-9,20H,4-7,10H2,1H3 |
| InChIKey | YPZVRYLGRIHDNO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|